C32H46O11 — CID 85164955
[4-[[8-(3a,4,5,6a-tetrahydrofuro[2,3-b]furan-5-yl)-5-acetyloxy-7,8-dimethylspiro[2,3,5,6,7,8a-hexahydro-1H-naphthalene-4,2'-oxirane]-4a-yl]methoxy]-4-oxobutan-2-yl] 3-acetyloxybutanoate (PubChem CID 85164955) has the molecular formula C32H46O11 and a molecular weight of 606.71 g/mol. Its IUPAC name is [4-[[8-(3a,4,5,6a-tetrahydrofuro[2,3-b]furan-5-yl)-5-acetyloxy-7,8-dimethylspiro[2,3,5,6,7,8a-hexahydro-1H-naphthalene-4,2'-oxirane]-4a-yl]methoxy]-4-oxobutan-2-yl] 3-acetyloxybutanoate.
| Compound Name | [4-[[8-(3a,4,5,6a-tetrahydrofuro[2,3-b]furan-5-yl)-5-acetyloxy-7,8-dimethylspiro[2,3,5,6,7,8a-hexahydro-1H-naphthalene-4,2'-oxirane]-4a-yl]methoxy]-4-oxobutan-2-yl] 3-acetyloxybutanoate |
|---|---|
| PubChem CID | 85164955 |
| Molecular Formula | C32H46O11 |
| Molecular Weight | 606.71 g/mol |
| Exact Mass | 606.30 |
| IUPAC Name | [4-[[8-(3a,4,5,6a-tetrahydrofuro[2,3-b]furan-5-yl)-5-acetyloxy-7,8-dimethylspiro[2,3,5,6,7,8a-hexahydro-1H-naphthalene-4,2'-oxirane]-4a-yl]methoxy]-4-oxobutan-2-yl] 3-acetyloxybutanoate |
| SMILES | CC(=O)OC(C)CC(=O)OC(C)CC(=O)OCC12C(OC(C)=O)CC(C)C(C)(C3CC4C=COC4O3)C1CCCC21CO1 |
| InChI | InChI=1S/C32H46O11/c1-18-12-26(42-22(5)34)32(17-38-27(35)13-20(3)41-28(36)14-19(2)40-21(4)33)24(8-7-10-31(32)16-39-31)30(18,6)25-15-23-9-11-37-29(23)43-25/h9,11,18-20,23-26,29H,7-8,10,12-17H2,1-6H3 |
| InChIKey | LSEZGUSNRPXEKV-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 136.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.71 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|