C19H30O5 — CID 125113886
[(4R,4aR,5S,7R,8aS)-5-acetyloxy-7,8,8-trimethylspiro[2,3,5,6,7,8a-hexahydro-1H-naphthalene-4,2'-oxirane]-4a-yl]methyl acetate (PubChem CID 125113886) has the molecular formula C19H30O5 and a molecular weight of 338.44 g/mol. Its IUPAC name is [(4R,4aR,5S,7R,8aS)-5-acetyloxy-7,8,8-trimethylspiro[2,3,5,6,7,8a-hexahydro-1H-naphthalene-4,2'-oxirane]-4a-yl]methyl acetate.
| Compound Name | [(4R,4aR,5S,7R,8aS)-5-acetyloxy-7,8,8-trimethylspiro[2,3,5,6,7,8a-hexahydro-1H-naphthalene-4,2'-oxirane]-4a-yl]methyl acetate |
|---|---|
| PubChem CID | 125113886 |
| Molecular Formula | C19H30O5 |
| Molecular Weight | 338.44 g/mol |
| Exact Mass | 338.21 |
| IUPAC Name | [(4R,4aR,5S,7R,8aS)-5-acetyloxy-7,8,8-trimethylspiro[2,3,5,6,7,8a-hexahydro-1H-naphthalene-4,2'-oxirane]-4a-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@]12[C@@H](OC(C)=O)C[C@@H](C)C(C)(C)[C@@H]1CCC[C@]21CO1 |
| InChI | InChI=1S/C19H30O5/c1-12-9-16(24-14(3)21)19(11-22-13(2)20)15(17(12,4)5)7-6-8-18(19)10-23-18/h12,15-16H,6-11H2,1-5H3/t12-,15+,16+,18+,19+/m1/s1 |
| InChIKey | PZHIPRLWEBZWMY-XVPBMSJJSA-N |
| XLogP | 3.10 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.44 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|