C22H34O6 — CID 73256998
[2-acetyloxy-5-(2-hydroxypropan-2-yl)-2a,7a-dimethyl-1a,2,3,4,5,5a,6,7-octahydroazuleno[6,7-b]oxiren-6-yl] 2-methylbut-2-enoate (PubChem CID 73256998) has the molecular formula C22H34O6 and a molecular weight of 394.51 g/mol. Its IUPAC name is [2-acetyloxy-5-(2-hydroxypropan-2-yl)-2a,7a-dimethyl-1a,2,3,4,5,5a,6,7-octahydroazuleno[6,7-b]oxiren-6-yl] 2-methylbut-2-enoate.
| Compound Name | [2-acetyloxy-5-(2-hydroxypropan-2-yl)-2a,7a-dimethyl-1a,2,3,4,5,5a,6,7-octahydroazuleno[6,7-b]oxiren-6-yl] 2-methylbut-2-enoate |
|---|---|
| PubChem CID | 73256998 |
| Molecular Formula | C22H34O6 |
| Molecular Weight | 394.51 g/mol |
| Exact Mass | 394.24 |
| IUPAC Name | [2-acetyloxy-5-(2-hydroxypropan-2-yl)-2a,7a-dimethyl-1a,2,3,4,5,5a,6,7-octahydroazuleno[6,7-b]oxiren-6-yl] 2-methylbut-2-enoate |
| SMILES | CC=C(C)C(=O)OC1CC2(C)OC2C(OC(C)=O)C2(C)CCC(C(C)(C)O)C12 |
| InChI | InChI=1S/C22H34O6/c1-8-12(2)19(24)27-15-11-22(7)18(28-22)17(26-13(3)23)21(6)10-9-14(16(15)21)20(4,5)25/h8,14-18,25H,9-11H2,1-7H3 |
| InChIKey | BNJXCVJHJPMDGV-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.51 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|