C25H38O7 — CID 162992683
[(1aR,2R,2aS,3S,5R,5aS,6S,7aS)-3,5-dihydroxy-2a,7a-dimethyl-2-(2-methylbut-2-enoyloxy)-5-propan-2-yl-2,3,4,5a,6,7-hexahydro-1aH-azuleno[6,7-b]oxiren-6-yl] 2-methylbut-2-enoate (PubChem CID 162992683) has the molecular formula C25H38O7 and a molecular weight of 450.57 g/mol. Its IUPAC name is [(1aR,2R,2aS,3S,5R,5aS,6S,7aS)-3,5-dihydroxy-2a,7a-dimethyl-2-(2-methylbut-2-enoyloxy)-5-propan-2-yl-2,3,4,5a,6,7-hexahydro-1aH-azuleno[6,7-b]oxiren-6-yl] 2-methylbut-2-enoate.
| Compound Name | [(1aR,2R,2aS,3S,5R,5aS,6S,7aS)-3,5-dihydroxy-2a,7a-dimethyl-2-(2-methylbut-2-enoyloxy)-5-propan-2-yl-2,3,4,5a,6,7-hexahydro-1aH-azuleno[6,7-b]oxiren-6-yl] 2-methylbut-2-enoate |
|---|---|
| PubChem CID | 162992683 |
| Molecular Formula | C25H38O7 |
| Molecular Weight | 450.57 g/mol |
| Exact Mass | 450.26 |
| IUPAC Name | [(1aR,2R,2aS,3S,5R,5aS,6S,7aS)-3,5-dihydroxy-2a,7a-dimethyl-2-(2-methylbut-2-enoyloxy)-5-propan-2-yl-2,3,4,5a,6,7-hexahydro-1aH-azuleno[6,7-b]oxiren-6-yl] 2-methylbut-2-enoate |
| SMILES | CC=C(C)C(=O)O[C@H]1C[C@]2(C)O[C@@H]2[C@H](OC(=O)C(C)=CC)[C@@]2(C)[C@@H]1[C@](O)(C(C)C)C[C@@H]2O |
| InChI | InChI=1S/C25H38O7/c1-9-14(5)21(27)30-16-11-23(7)19(32-23)20(31-22(28)15(6)10-2)24(8)17(26)12-25(29,13(3)4)18(16)24/h9-10,13,16-20,26,29H,11-12H2,1-8H3/t16-,17-,18+,19+,20-,23-,24+,25+/m0/s1 |
| InChIKey | UOXMDDHNODVBCV-MJLVUYKYSA-N |
| XLogP | 3.08 |
| TPSA | 105.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.57 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|