C20H34O4 — CID 163041294
[(1aS,2aR,5R,5aS,6S,7aR)-5-hydroxy-2a,7a-dimethyl-5-propan-2-yl-2,3,4,5a,6,7-hexahydro-1aH-azuleno[6,7-b]oxiren-6-yl] 3-methylbutanoate (PubChem CID 163041294) has the molecular formula C20H34O4 and a molecular weight of 338.49 g/mol. Its IUPAC name is [(1aS,2aR,5R,5aS,6S,7aR)-5-hydroxy-2a,7a-dimethyl-5-propan-2-yl-2,3,4,5a,6,7-hexahydro-1aH-azuleno[6,7-b]oxiren-6-yl] 3-methylbutanoate.
| Compound Name | [(1aS,2aR,5R,5aS,6S,7aR)-5-hydroxy-2a,7a-dimethyl-5-propan-2-yl-2,3,4,5a,6,7-hexahydro-1aH-azuleno[6,7-b]oxiren-6-yl] 3-methylbutanoate |
|---|---|
| PubChem CID | 163041294 |
| Molecular Formula | C20H34O4 |
| Molecular Weight | 338.49 g/mol |
| Exact Mass | 338.25 |
| IUPAC Name | [(1aS,2aR,5R,5aS,6S,7aR)-5-hydroxy-2a,7a-dimethyl-5-propan-2-yl-2,3,4,5a,6,7-hexahydro-1aH-azuleno[6,7-b]oxiren-6-yl] 3-methylbutanoate |
| SMILES | CC(C)CC(=O)O[C@H]1C[C@@]2(C)O[C@H]2C[C@@]2(C)CC[C@@](O)(C(C)C)[C@H]12 |
| InChI | InChI=1S/C20H34O4/c1-12(2)9-16(21)23-14-10-19(6)15(24-19)11-18(5)7-8-20(22,13(3)4)17(14)18/h12-15,17,22H,7-11H2,1-6H3/t14-,15-,17+,18+,19+,20+/m0/s1 |
| InChIKey | UGZZUIVLQIFCMS-QFDSZWTGSA-N |
| XLogP | 3.70 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.49 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|