C20H34O3 — CID 162915261
[(3R,3aS,4S,8aR)-3-hydroxy-6,8a-dimethyl-3-propan-2-yl-1,2,3a,4,5,8-hexahydroazulen-4-yl] (2R)-2-methylbutanoate (PubChem CID 162915261) has the molecular formula C20H34O3 and a molecular weight of 322.49 g/mol. Its IUPAC name is [(3R,3aS,4S,8aR)-3-hydroxy-6,8a-dimethyl-3-propan-2-yl-1,2,3a,4,5,8-hexahydroazulen-4-yl] (2R)-2-methylbutanoate.
| Compound Name | [(3R,3aS,4S,8aR)-3-hydroxy-6,8a-dimethyl-3-propan-2-yl-1,2,3a,4,5,8-hexahydroazulen-4-yl] (2R)-2-methylbutanoate |
|---|---|
| PubChem CID | 162915261 |
| Molecular Formula | C20H34O3 |
| Molecular Weight | 322.49 g/mol |
| Exact Mass | 322.25 |
| IUPAC Name | [(3R,3aS,4S,8aR)-3-hydroxy-6,8a-dimethyl-3-propan-2-yl-1,2,3a,4,5,8-hexahydroazulen-4-yl] (2R)-2-methylbutanoate |
| SMILES | CC[C@@H](C)C(=O)O[C@H]1CC(C)=CC[C@@]2(C)CC[C@@](O)(C(C)C)[C@H]12 |
| InChI | InChI=1S/C20H34O3/c1-7-15(5)18(21)23-16-12-14(4)8-9-19(6)10-11-20(22,13(2)3)17(16)19/h8,13,15-17,22H,7,9-12H2,1-6H3/t15-,16+,17-,19+,20-/m1/s1 |
| InChIKey | OAQCXNPKDNTWGN-FPPGBKCQSA-N |
| XLogP | 4.49 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.49 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|