C20H32O2 — CID 23425776
(1S,3aS,5E,8Z,10R,12aS)-1-hydroxy-3a,6,10-trimethyl-1-propan-2-yl-3,4,7,10,12,12a-hexahydro-2H-cyclopenta[11]annulen-11-one (PubChem CID 23425776) has the molecular formula C20H32O2 and a molecular weight of 304.47 g/mol. Its IUPAC name is (1S,3aS,5E,8Z,10R,12aS)-1-hydroxy-3a,6,10-trimethyl-1-propan-2-yl-3,4,7,10,12,12a-hexahydro-2H-cyclopenta[11]annulen-11-one.
| Compound Name | (1S,3aS,5E,8Z,10R,12aS)-1-hydroxy-3a,6,10-trimethyl-1-propan-2-yl-3,4,7,10,12,12a-hexahydro-2H-cyclopenta[11]annulen-11-one |
|---|---|
| PubChem CID | 23425776 |
| Molecular Formula | C20H32O2 |
| Molecular Weight | 304.47 g/mol |
| Exact Mass | 304.24 |
| IUPAC Name | (1S,3aS,5E,8Z,10R,12aS)-1-hydroxy-3a,6,10-trimethyl-1-propan-2-yl-3,4,7,10,12,12a-hexahydro-2H-cyclopenta[11]annulen-11-one |
| SMILES | C/C1=C\C[C@]2(C)CC[C@](O)(C(C)C)[C@H]2CC(=O)[C@H](C)/C=C\C1 |
| InChI | InChI=1S/C20H32O2/c1-14(2)20(22)12-11-19(5)10-9-15(3)7-6-8-16(4)17(21)13-18(19)20/h6,8-9,14,16,18,22H,7,10-13H2,1-5H3/b8-6-,15-9+/t16-,18+,19-,20+/m1/s1 |
| InChIKey | AQENECCHXKWCKP-FQPXOIIOSA-N |
| XLogP | 4.68 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.47 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|