C20H30O2 — CID 163090589
(3S,5aR,9aS,10aR)-3-hydroxy-5a,9,10a-trimethyl-3-propan-2-yl-1,2,3a,4,5,9a-hexahydrobenzo[f]azulen-10-one (PubChem CID 163090589) has the molecular formula C20H30O2 and a molecular weight of 302.46 g/mol. Its IUPAC name is (3S,5aR,9aS,10aR)-3-hydroxy-5a,9,10a-trimethyl-3-propan-2-yl-1,2,3a,4,5,9a-hexahydrobenzo[f]azulen-10-one.
| Compound Name | (3S,5aR,9aS,10aR)-3-hydroxy-5a,9,10a-trimethyl-3-propan-2-yl-1,2,3a,4,5,9a-hexahydrobenzo[f]azulen-10-one |
|---|---|
| PubChem CID | 163090589 |
| Molecular Formula | C20H30O2 |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | (3S,5aR,9aS,10aR)-3-hydroxy-5a,9,10a-trimethyl-3-propan-2-yl-1,2,3a,4,5,9a-hexahydrobenzo[f]azulen-10-one |
| SMILES | CC1=CC=C[C@@]2(C)CCC3[C@@](O)(C(C)C)CC[C@@]3(C)C(=O)[C@@H]12 |
| InChI | InChI=1S/C20H30O2/c1-13(2)20(22)12-11-19(5)15(20)8-10-18(4)9-6-7-14(3)16(18)17(19)21/h6-7,9,13,15-16,22H,8,10-12H2,1-5H3/t15?,16-,18+,19-,20+/m1/s1 |
| InChIKey | XCZDELNYRRPFNI-VAILLSOISA-N |
| XLogP | 4.29 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |