C15H22O3 — CID 163182045
9-hydroxy-1-methyl-2-methylidene-9-propan-2-yl-5-oxatricyclo[5.4.0.03,8]undecan-4-one (PubChem CID 163182045) has the molecular formula C15H22O3 and a molecular weight of 250.34 g/mol. Its IUPAC name is 9-hydroxy-1-methyl-2-methylidene-9-propan-2-yl-5-oxatricyclo[5.4.0.03,8]undecan-4-one.
| Compound Name | 9-hydroxy-1-methyl-2-methylidene-9-propan-2-yl-5-oxatricyclo[5.4.0.03,8]undecan-4-one |
|---|---|
| PubChem CID | 163182045 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | 9-hydroxy-1-methyl-2-methylidene-9-propan-2-yl-5-oxatricyclo[5.4.0.03,8]undecan-4-one |
| SMILES | C=C1C2C(=O)OCC3C2C(O)(C(C)C)CCC13C |
| InChI | InChI=1S/C15H22O3/c1-8(2)15(17)6-5-14(4)9(3)11-12(15)10(14)7-18-13(11)16/h8,10-12,17H,3,5-7H2,1-2,4H3 |
| InChIKey | ZMBFPDXZPOYLBF-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|