C19H30O3 — CID 163107922
(1S,4R,6R,8E,11S,14S)-14-hydroxy-4,8,11-trimethyl-14-propan-2-yl-5-oxatricyclo[9.3.0.04,6]tetradec-8-en-3-one (PubChem CID 163107922) has the molecular formula C19H30O3 and a molecular weight of 306.45 g/mol. Its IUPAC name is (1S,4R,6R,8E,11S,14S)-14-hydroxy-4,8,11-trimethyl-14-propan-2-yl-5-oxatricyclo[9.3.0.04,6]tetradec-8-en-3-one.
| Compound Name | (1S,4R,6R,8E,11S,14S)-14-hydroxy-4,8,11-trimethyl-14-propan-2-yl-5-oxatricyclo[9.3.0.04,6]tetradec-8-en-3-one |
|---|---|
| PubChem CID | 163107922 |
| Molecular Formula | C19H30O3 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.22 |
| IUPAC Name | (1S,4R,6R,8E,11S,14S)-14-hydroxy-4,8,11-trimethyl-14-propan-2-yl-5-oxatricyclo[9.3.0.04,6]tetradec-8-en-3-one |
| SMILES | C/C1=C\C[C@]2(C)CC[C@](O)(C(C)C)[C@H]2CC(=O)[C@]2(C)O[C@@H]2C1 |
| InChI | InChI=1S/C19H30O3/c1-12(2)19(21)9-8-17(4)7-6-13(3)10-16-18(5,22-16)15(20)11-14(17)19/h6,12,14,16,21H,7-11H2,1-5H3/b13-6+/t14-,16+,17+,18-,19-/m0/s1 |
| InChIKey | CMWRFNOOSGGSGM-PSICOIMESA-N |
| XLogP | 3.65 |
| TPSA | 49.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|