C21H34O3 — CID 54356437
7,8-dihydroxy-2,4b,7,10a-tetramethyl-2-propan-2-yl-5,6,8,8a,9,10-hexahydro-4aH-phenanthren-1-one (PubChem CID 54356437) has the molecular formula C21H34O3 and a molecular weight of 334.50 g/mol. Its IUPAC name is 7,8-dihydroxy-2,4b,7,10a-tetramethyl-2-propan-2-yl-5,6,8,8a,9,10-hexahydro-4aH-phenanthren-1-one.
| Compound Name | 7,8-dihydroxy-2,4b,7,10a-tetramethyl-2-propan-2-yl-5,6,8,8a,9,10-hexahydro-4aH-phenanthren-1-one |
|---|---|
| PubChem CID | 54356437 |
| Molecular Formula | C21H34O3 |
| Molecular Weight | 334.50 g/mol |
| Exact Mass | 334.25 |
| IUPAC Name | 7,8-dihydroxy-2,4b,7,10a-tetramethyl-2-propan-2-yl-5,6,8,8a,9,10-hexahydro-4aH-phenanthren-1-one |
| SMILES | CC(C)C1(C)C=CC2C(C)(CCC3C(O)C(C)(O)CCC32C)C1=O |
| InChI | InChI=1S/C21H34O3/c1-13(2)18(3)10-8-15-19(4)11-12-21(6,24)16(22)14(19)7-9-20(15,5)17(18)23/h8,10,13-16,22,24H,7,9,11-12H2,1-6H3 |
| InChIKey | UJKQLSKDBCRZQW-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.50 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|