C12H20O3 — CID 174909794
7-oxabicyclo[4.1.0]heptan-1-ylmethyl 2,2-dimethylpropanoate (PubChem CID 174909794) has the molecular formula C12H20O3 and a molecular weight of 212.29 g/mol. Its IUPAC name is 7-oxabicyclo[4.1.0]heptan-1-ylmethyl 2,2-dimethylpropanoate.
| Compound Name | 7-oxabicyclo[4.1.0]heptan-1-ylmethyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 174909794 |
| Molecular Formula | C12H20O3 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | 7-oxabicyclo[4.1.0]heptan-1-ylmethyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OCC12CCCCC1O2 |
| InChI | InChI=1S/C12H20O3/c1-11(2,3)10(13)14-8-12-7-5-4-6-9(12)15-12/h9H,4-8H2,1-3H3 |
| InChIKey | FTXFSBKRLCGMAD-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|