C11H18O4 — CID 175319838
2-(7-oxabicyclo[4.1.0]heptan-1-yl)ethanol;prop-2-enoic acid (PubChem CID 175319838) has the molecular formula C11H18O4 and a molecular weight of 214.26 g/mol. Its IUPAC name is 2-(7-oxabicyclo[4.1.0]heptan-1-yl)ethanol;prop-2-enoic acid.
| Compound Name | 2-(7-oxabicyclo[4.1.0]heptan-1-yl)ethanol;prop-2-enoic acid |
|---|---|
| PubChem CID | 175319838 |
| Molecular Formula | C11H18O4 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | 2-(7-oxabicyclo[4.1.0]heptan-1-yl)ethanol;prop-2-enoic acid |
| SMILES | C=CC(=O)O.OCCC12CCCCC1O2 |
| InChI | InChI=1S/C8H14O2.C3H4O2/c9-6-5-8-4-2-1-3-7(8)10-8;1-2-3(4)5/h7,9H,1-6H2;2H,1H2,(H,4,5) |
| InChIKey | DRRJNCWKLUDXIA-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 70.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|