C22H32O7 — CID 162950630
[(2S,3S,6S)-2-(acetyloxymethyl)-2,6-dimethyl-6-[(1R,3R,6R)-6-methyl-2-oxo-7-oxabicyclo[4.1.0]heptan-3-yl]oxan-3-yl] 2-methylbut-2-enoate (PubChem CID 162950630) has the molecular formula C22H32O7 and a molecular weight of 408.49 g/mol. Its IUPAC name is [(2S,3S,6S)-2-(acetyloxymethyl)-2,6-dimethyl-6-[(1R,3R,6R)-6-methyl-2-oxo-7-oxabicyclo[4.1.0]heptan-3-yl]oxan-3-yl] 2-methylbut-2-enoate.
| Compound Name | [(2S,3S,6S)-2-(acetyloxymethyl)-2,6-dimethyl-6-[(1R,3R,6R)-6-methyl-2-oxo-7-oxabicyclo[4.1.0]heptan-3-yl]oxan-3-yl] 2-methylbut-2-enoate |
|---|---|
| PubChem CID | 162950630 |
| Molecular Formula | C22H32O7 |
| Molecular Weight | 408.49 g/mol |
| Exact Mass | 408.21 |
| IUPAC Name | [(2S,3S,6S)-2-(acetyloxymethyl)-2,6-dimethyl-6-[(1R,3R,6R)-6-methyl-2-oxo-7-oxabicyclo[4.1.0]heptan-3-yl]oxan-3-yl] 2-methylbut-2-enoate |
| SMILES | CC=C(C)C(=O)O[C@H]1CC[C@@](C)([C@H]2CC[C@@]3(C)O[C@H]3C2=O)O[C@@]1(C)COC(C)=O |
| InChI | InChI=1S/C22H32O7/c1-7-13(2)19(25)27-16-9-11-20(4,29-22(16,6)12-26-14(3)23)15-8-10-21(5)18(28-21)17(15)24/h7,15-16,18H,8-12H2,1-6H3/t15-,16-,18-,20-,21+,22-/m0/s1 |
| InChIKey | YNWMJCUBUPIGGR-QDYRLFESSA-N |
| XLogP | 2.89 |
| TPSA | 91.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.49 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|