C20H30O5 — CID 162955721
(1-hydroxy-1,3',3',4a-tetramethyl-6-oxospiro[2,3,4,5,8,8a-hexahydronaphthalene-7,2'-oxirane]-2-yl) 2-methylbut-2-enoate (PubChem CID 162955721) has the molecular formula C20H30O5 and a molecular weight of 350.46 g/mol. Its IUPAC name is (1-hydroxy-1,3',3',4a-tetramethyl-6-oxospiro[2,3,4,5,8,8a-hexahydronaphthalene-7,2'-oxirane]-2-yl) 2-methylbut-2-enoate.
| Compound Name | (1-hydroxy-1,3',3',4a-tetramethyl-6-oxospiro[2,3,4,5,8,8a-hexahydronaphthalene-7,2'-oxirane]-2-yl) 2-methylbut-2-enoate |
|---|---|
| PubChem CID | 162955721 |
| Molecular Formula | C20H30O5 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | (1-hydroxy-1,3',3',4a-tetramethyl-6-oxospiro[2,3,4,5,8,8a-hexahydronaphthalene-7,2'-oxirane]-2-yl) 2-methylbut-2-enoate |
| SMILES | CC=C(C)C(=O)OC1CCC2(C)CC(=O)C3(CC2C1(C)O)OC3(C)C |
| InChI | InChI=1S/C20H30O5/c1-7-12(2)16(22)24-15-8-9-18(5)11-14(21)20(17(3,4)25-20)10-13(18)19(15,6)23/h7,13,15,23H,8-11H2,1-6H3 |
| InChIKey | VXPUNMVIAYIYHG-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|