C20H34O4 — CID 163012216
[(1R,3aS,5S,6R,8aR)-6,8a-dihydroxy-3a,6-dimethyl-1-propan-2-yl-2,3,4,5,7,8-hexahydro-1H-azulen-5-yl] (E)-2-methylbut-2-enoate (PubChem CID 163012216) has the molecular formula C20H34O4 and a molecular weight of 338.49 g/mol. Its IUPAC name is [(1R,3aS,5S,6R,8aR)-6,8a-dihydroxy-3a,6-dimethyl-1-propan-2-yl-2,3,4,5,7,8-hexahydro-1H-azulen-5-yl] (E)-2-methylbut-2-enoate.
| Compound Name | [(1R,3aS,5S,6R,8aR)-6,8a-dihydroxy-3a,6-dimethyl-1-propan-2-yl-2,3,4,5,7,8-hexahydro-1H-azulen-5-yl] (E)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 163012216 |
| Molecular Formula | C20H34O4 |
| Molecular Weight | 338.49 g/mol |
| Exact Mass | 338.25 |
| IUPAC Name | [(1R,3aS,5S,6R,8aR)-6,8a-dihydroxy-3a,6-dimethyl-1-propan-2-yl-2,3,4,5,7,8-hexahydro-1H-azulen-5-yl] (E)-2-methylbut-2-enoate |
| SMILES | C/C=C(\C)C(=O)O[C@H]1C[C@]2(C)CC[C@H](C(C)C)[C@]2(O)CC[C@@]1(C)O |
| InChI | InChI=1S/C20H34O4/c1-7-14(4)17(21)24-16-12-18(5)9-8-15(13(2)3)20(18,23)11-10-19(16,6)22/h7,13,15-16,22-23H,8-12H2,1-6H3/b14-7+/t15-,16+,18+,19-,20-/m1/s1 |
| InChIKey | SARMJLPHTLNPQI-AIEXHPMCSA-N |
| XLogP | 3.60 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.49 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|