C15H27NO3 — CID 123962636
[4-(hydroxyamino)-3,3,5,5-tetramethylcyclohexyl] (Z)-2-methylbut-2-enoate (PubChem CID 123962636) has the molecular formula C15H27NO3 and a molecular weight of 269.38 g/mol. Its IUPAC name is [4-(hydroxyamino)-3,3,5,5-tetramethylcyclohexyl] (Z)-2-methylbut-2-enoate.
| Compound Name | [4-(hydroxyamino)-3,3,5,5-tetramethylcyclohexyl] (Z)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 123962636 |
| Molecular Formula | C15H27NO3 |
| Molecular Weight | 269.38 g/mol |
| Exact Mass | 269.20 |
| IUPAC Name | [4-(hydroxyamino)-3,3,5,5-tetramethylcyclohexyl] (Z)-2-methylbut-2-enoate |
| SMILES | C/C=C(/C)C(=O)OC1CC(C)(C)C(NO)C(C)(C)C1 |
| InChI | InChI=1S/C15H27NO3/c1-7-10(2)12(17)19-11-8-14(3,4)13(16-18)15(5,6)9-11/h7,11,13,16,18H,8-9H2,1-6H3/b10-7- |
| InChIKey | UZPTWXPGXWSZTI-YFHOEESVSA-N |
| XLogP | 3.06 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.38 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|