C23H34O5 — CID 162972965
(6,8a-dihydroxy-3a,6-dimethyl-1-propan-2-yl-2,3,4,5,7,8-hexahydro-1H-azulen-5-yl) 4-methoxybenzoate (PubChem CID 162972965) has the molecular formula C23H34O5 and a molecular weight of 390.52 g/mol. Its IUPAC name is (6,8a-dihydroxy-3a,6-dimethyl-1-propan-2-yl-2,3,4,5,7,8-hexahydro-1H-azulen-5-yl) 4-methoxybenzoate.
| Compound Name | (6,8a-dihydroxy-3a,6-dimethyl-1-propan-2-yl-2,3,4,5,7,8-hexahydro-1H-azulen-5-yl) 4-methoxybenzoate |
|---|---|
| PubChem CID | 162972965 |
| Molecular Formula | C23H34O5 |
| Molecular Weight | 390.52 g/mol |
| Exact Mass | 390.24 |
| IUPAC Name | (6,8a-dihydroxy-3a,6-dimethyl-1-propan-2-yl-2,3,4,5,7,8-hexahydro-1H-azulen-5-yl) 4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)OC2CC3(C)CCC(C(C)C)C3(O)CCC2(C)O)cc1 |
| InChI | InChI=1S/C23H34O5/c1-15(2)18-10-11-21(3)14-19(22(4,25)12-13-23(18,21)26)28-20(24)16-6-8-17(27-5)9-7-16/h6-9,15,18-19,25-26H,10-14H2,1-5H3 |
| InChIKey | VFAPTYDTAUCZCR-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.52 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |