C25H28O7 — CID 170308238
[(3aS,6aS)-3-[2-(4-methoxyphenyl)-2-oxoethyl]-3a,6a-dimethyl-2,3,5,6-tetrahydrofuro[3,2-b]furan-6-yl] 4-methoxybenzoate (PubChem CID 170308238) has the molecular formula C25H28O7 and a molecular weight of 440.49 g/mol. Its IUPAC name is [(3aS,6aS)-3-[2-(4-methoxyphenyl)-2-oxoethyl]-3a,6a-dimethyl-2,3,5,6-tetrahydrofuro[3,2-b]furan-6-yl] 4-methoxybenzoate.
| Compound Name | [(3aS,6aS)-3-[2-(4-methoxyphenyl)-2-oxoethyl]-3a,6a-dimethyl-2,3,5,6-tetrahydrofuro[3,2-b]furan-6-yl] 4-methoxybenzoate |
|---|---|
| PubChem CID | 170308238 |
| Molecular Formula | C25H28O7 |
| Molecular Weight | 440.49 g/mol |
| Exact Mass | 440.18 |
| IUPAC Name | [(3aS,6aS)-3-[2-(4-methoxyphenyl)-2-oxoethyl]-3a,6a-dimethyl-2,3,5,6-tetrahydrofuro[3,2-b]furan-6-yl] 4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)CC2CO[C@@]3(C)C(OC(=O)c4ccc(OC)cc4)CO[C@@]23C)cc1 |
| InChI | InChI=1S/C25H28O7/c1-24-18(13-21(26)16-5-9-19(28-3)10-6-16)14-30-25(24,2)22(15-31-24)32-23(27)17-7-11-20(29-4)12-8-17/h5-12,18,22H,13-15H2,1-4H3/t18?,22?,24-,25-/m0/s1 |
| InChIKey | AJQRKSXITUQTMU-HTWNWYANSA-N |
| XLogP | 3.70 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.49 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |