C17H18O5 — CID 51014786
methyl (1R,2S,4R)-2-(4-methoxybenzoyl)oxybicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 51014786) has the molecular formula C17H18O5 and a molecular weight of 302.33 g/mol. Its IUPAC name is methyl (1R,2S,4R)-2-(4-methoxybenzoyl)oxybicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | methyl (1R,2S,4R)-2-(4-methoxybenzoyl)oxybicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 51014786 |
| Molecular Formula | C17H18O5 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | methyl (1R,2S,4R)-2-(4-methoxybenzoyl)oxybicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | COC(=O)[C@]1(OC(=O)c2ccc(OC)cc2)C[C@@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C17H18O5/c1-20-14-7-4-12(5-8-14)15(18)22-17(16(19)21-2)10-11-3-6-13(17)9-11/h3-8,11,13H,9-10H2,1-2H3/t11-,13+,17+/m1/s1 |
| InChIKey | GWQLCSXGIJEYKJ-ZUCKAHLUSA-N |
| XLogP | 2.36 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|