C20H28O5 — CID 156602849
(5-hydroxy-6,6,9a-trimethyl-1-oxo-4,5,5a,7,8,9-hexahydro-3H-benzo[e][2]benzofuran-7-yl) 2-methylbut-2-enoate (PubChem CID 156602849) has the molecular formula C20H28O5 and a molecular weight of 348.44 g/mol. Its IUPAC name is (5-hydroxy-6,6,9a-trimethyl-1-oxo-4,5,5a,7,8,9-hexahydro-3H-benzo[e][2]benzofuran-7-yl) 2-methylbut-2-enoate.
| Compound Name | (5-hydroxy-6,6,9a-trimethyl-1-oxo-4,5,5a,7,8,9-hexahydro-3H-benzo[e][2]benzofuran-7-yl) 2-methylbut-2-enoate |
|---|---|
| PubChem CID | 156602849 |
| Molecular Formula | C20H28O5 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.19 |
| IUPAC Name | (5-hydroxy-6,6,9a-trimethyl-1-oxo-4,5,5a,7,8,9-hexahydro-3H-benzo[e][2]benzofuran-7-yl) 2-methylbut-2-enoate |
| SMILES | CC=C(C)C(=O)OC1CCC2(C)C3=C(COC3=O)CC(O)C2C1(C)C |
| InChI | InChI=1S/C20H28O5/c1-6-11(2)17(22)25-14-7-8-20(5)15-12(10-24-18(15)23)9-13(21)16(20)19(14,3)4/h6,13-14,16,21H,7-10H2,1-5H3 |
| InChIKey | IAZUVEJIBOPWEG-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|