C20H24O4 — CID 163013326
(8a-methyl-1,5-dimethylidene-2-oxo-3a,4,7,8,9,9a-hexahydroazuleno[6,5-b]furan-9-yl) 2-methylbut-2-enoate (PubChem CID 163013326) has the molecular formula C20H24O4 and a molecular weight of 328.41 g/mol. Its IUPAC name is (8a-methyl-1,5-dimethylidene-2-oxo-3a,4,7,8,9,9a-hexahydroazuleno[6,5-b]furan-9-yl) 2-methylbut-2-enoate.
| Compound Name | (8a-methyl-1,5-dimethylidene-2-oxo-3a,4,7,8,9,9a-hexahydroazuleno[6,5-b]furan-9-yl) 2-methylbut-2-enoate |
|---|---|
| PubChem CID | 163013326 |
| Molecular Formula | C20H24O4 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | (8a-methyl-1,5-dimethylidene-2-oxo-3a,4,7,8,9,9a-hexahydroazuleno[6,5-b]furan-9-yl) 2-methylbut-2-enoate |
| SMILES | C=C1CC2OC(=O)C(=C)C2C(OC(=O)C(C)=CC)C2(C)CCC=C12 |
| InChI | InChI=1S/C20H24O4/c1-6-11(2)18(21)24-17-16-13(4)19(22)23-15(16)10-12(3)14-8-7-9-20(14,17)5/h6,8,15-17H,3-4,7,9-10H2,1-2,5H3 |
| InChIKey | OBAAEFQEMINIAB-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|