C20H22O6 — CID 162998757
(4-ethenyl-4-methyl-3,8-dimethylidene-2,7-dioxo-5,5a,8a,8b-tetrahydro-3aH-furo[2,3-g][1]benzofuran-5-yl) 2-methylbut-2-enoate (PubChem CID 162998757) has the molecular formula C20H22O6 and a molecular weight of 358.39 g/mol. Its IUPAC name is (4-ethenyl-4-methyl-3,8-dimethylidene-2,7-dioxo-5,5a,8a,8b-tetrahydro-3aH-furo[2,3-g][1]benzofuran-5-yl) 2-methylbut-2-enoate.
| Compound Name | (4-ethenyl-4-methyl-3,8-dimethylidene-2,7-dioxo-5,5a,8a,8b-tetrahydro-3aH-furo[2,3-g][1]benzofuran-5-yl) 2-methylbut-2-enoate |
|---|---|
| PubChem CID | 162998757 |
| Molecular Formula | C20H22O6 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | (4-ethenyl-4-methyl-3,8-dimethylidene-2,7-dioxo-5,5a,8a,8b-tetrahydro-3aH-furo[2,3-g][1]benzofuran-5-yl) 2-methylbut-2-enoate |
| SMILES | C=CC1(C)C(OC(=O)C(C)=CC)C2OC(=O)C(=C)C2C2OC(=O)C(=C)C21 |
| InChI | InChI=1S/C20H22O6/c1-7-9(3)17(21)26-16-15-12(10(4)18(22)25-15)14-13(20(16,6)8-2)11(5)19(23)24-14/h7-8,12-16H,2,4-5H2,1,3,6H3 |
| InChIKey | CQIIOAWCZWWOOF-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|