C20H24O6 — CID 162887211
(5a-ethenyl-6-hydroxy-3,9-dimethylidene-2-oxo-3a,4,5,6,9a,9b-hexahydrofuro[2,3-f]isochromen-4-yl) 2-methylbut-2-enoate (PubChem CID 162887211) has the molecular formula C20H24O6 and a molecular weight of 360.41 g/mol. Its IUPAC name is (5a-ethenyl-6-hydroxy-3,9-dimethylidene-2-oxo-3a,4,5,6,9a,9b-hexahydrofuro[2,3-f]isochromen-4-yl) 2-methylbut-2-enoate.
| Compound Name | (5a-ethenyl-6-hydroxy-3,9-dimethylidene-2-oxo-3a,4,5,6,9a,9b-hexahydrofuro[2,3-f]isochromen-4-yl) 2-methylbut-2-enoate |
|---|---|
| PubChem CID | 162887211 |
| Molecular Formula | C20H24O6 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | (5a-ethenyl-6-hydroxy-3,9-dimethylidene-2-oxo-3a,4,5,6,9a,9b-hexahydrofuro[2,3-f]isochromen-4-yl) 2-methylbut-2-enoate |
| SMILES | C=CC12CC(OC(=O)C(C)=CC)C3C(=C)C(=O)OC3C1C(=C)COC2O |
| InChI | InChI=1S/C20H24O6/c1-6-10(3)17(21)25-13-8-20(7-2)15(11(4)9-24-19(20)23)16-14(13)12(5)18(22)26-16/h6-7,13-16,19,23H,2,4-5,8-9H2,1,3H3 |
| InChIKey | YCUMYYHWRRPIJB-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|