C17H18O6 — CID 162986957
(5a-ethenyl-3,9-dimethylidene-2,6-dioxo-4,5,9a,9b-tetrahydro-3aH-furo[2,3-f]isochromen-4-yl) acetate (PubChem CID 162986957) has the molecular formula C17H18O6 and a molecular weight of 318.33 g/mol. Its IUPAC name is (5a-ethenyl-3,9-dimethylidene-2,6-dioxo-4,5,9a,9b-tetrahydro-3aH-furo[2,3-f]isochromen-4-yl) acetate.
| Compound Name | (5a-ethenyl-3,9-dimethylidene-2,6-dioxo-4,5,9a,9b-tetrahydro-3aH-furo[2,3-f]isochromen-4-yl) acetate |
|---|---|
| PubChem CID | 162986957 |
| Molecular Formula | C17H18O6 |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | (5a-ethenyl-3,9-dimethylidene-2,6-dioxo-4,5,9a,9b-tetrahydro-3aH-furo[2,3-f]isochromen-4-yl) acetate |
| SMILES | C=CC12CC(OC(C)=O)C3C(=C)C(=O)OC3C1C(=C)COC2=O |
| InChI | InChI=1S/C17H18O6/c1-5-17-6-11(22-10(4)18)12-9(3)15(19)23-14(12)13(17)8(2)7-21-16(17)20/h5,11-14H,1-3,6-7H2,4H3 |
| InChIKey | VZCBOFSCMCPAHX-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|