C17H20O6 — CID 163019603
[(3aR,4S,5aR,6R,9aS,9bR)-5a-ethenyl-6-hydroxy-3,9-dimethylidene-2-oxo-3a,4,5,6,9a,9b-hexahydrofuro[2,3-f]isochromen-4-yl] acetate (PubChem CID 163019603) has the molecular formula C17H20O6 and a molecular weight of 320.34 g/mol. Its IUPAC name is [(3aR,4S,5aR,6R,9aS,9bR)-5a-ethenyl-6-hydroxy-3,9-dimethylidene-2-oxo-3a,4,5,6,9a,9b-hexahydrofuro[2,3-f]isochromen-4-yl] acetate.
| Compound Name | [(3aR,4S,5aR,6R,9aS,9bR)-5a-ethenyl-6-hydroxy-3,9-dimethylidene-2-oxo-3a,4,5,6,9a,9b-hexahydrofuro[2,3-f]isochromen-4-yl] acetate |
|---|---|
| PubChem CID | 163019603 |
| Molecular Formula | C17H20O6 |
| Molecular Weight | 320.34 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | [(3aR,4S,5aR,6R,9aS,9bR)-5a-ethenyl-6-hydroxy-3,9-dimethylidene-2-oxo-3a,4,5,6,9a,9b-hexahydrofuro[2,3-f]isochromen-4-yl] acetate |
| SMILES | C=C[C@]12C[C@H](OC(C)=O)[C@H]3C(=C)C(=O)O[C@@H]3[C@H]1C(=C)CO[C@H]2O |
| InChI | InChI=1S/C17H20O6/c1-5-17-6-11(22-10(4)18)12-9(3)15(19)23-14(12)13(17)8(2)7-21-16(17)20/h5,11-14,16,20H,1-3,6-7H2,4H3/t11-,12+,13+,14-,16+,17-/m0/s1 |
| InChIKey | SKZFWTVLHWTEAI-FVMKKRNSSA-N |
| XLogP | 1.11 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.34 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|