C20H24O7 — CID 10833346
[(1R,2R,4S,5S,6S,7S,8R)-6-[(E)-but-2-enoyl]-6-hydroxy-5-methyl-11-methylidene-10-oxo-3,9-dioxatricyclo[6.3.0.02,4]undecan-7-yl] (Z)-2-methylbut-2-enoate (PubChem CID 10833346) has the molecular formula C20H24O7 and a molecular weight of 376.41 g/mol. Its IUPAC name is [(1R,2R,4S,5S,6S,7S,8R)-6-[(E)-but-2-enoyl]-6-hydroxy-5-methyl-11-methylidene-10-oxo-3,9-dioxatricyclo[6.3.0.02,4]undecan-7-yl] (Z)-2-methylbut-2-enoate.
| Compound Name | [(1R,2R,4S,5S,6S,7S,8R)-6-[(E)-but-2-enoyl]-6-hydroxy-5-methyl-11-methylidene-10-oxo-3,9-dioxatricyclo[6.3.0.02,4]undecan-7-yl] (Z)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 10833346 |
| Molecular Formula | C20H24O7 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | [(1R,2R,4S,5S,6S,7S,8R)-6-[(E)-but-2-enoyl]-6-hydroxy-5-methyl-11-methylidene-10-oxo-3,9-dioxatricyclo[6.3.0.02,4]undecan-7-yl] (Z)-2-methylbut-2-enoate |
| SMILES | C=C1C(=O)O[C@@H]2[C@H]1[C@H]1O[C@H]1[C@H](C)[C@@](O)(C(=O)/C=C/C)[C@H]2OC(=O)/C(C)=C\C |
| InChI | InChI=1S/C20H24O7/c1-6-8-12(21)20(24)11(5)14-15(25-14)13-10(4)19(23)26-16(13)17(20)27-18(22)9(3)7-2/h6-8,11,13-17,24H,4H2,1-3,5H3/b8-6+,9-7-/t11-,13+,14-,15+,16+,17-,20+/m0/s1 |
| InChIKey | BHTATZDUYXWHPP-SEJMQKBLSA-N |
| XLogP | 1.26 |
| TPSA | 102.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|