C19H26O7 — CID 162860913
[(3aS,5R,6S,7S,8S,8aR)-7-[(E)-but-2-enoyl]-5,7-dihydroxy-6-methyl-3-methylidene-2-oxo-3a,4,5,6,8,8a-hexahydrocyclohepta[b]furan-8-yl] 2-methylpropanoate (PubChem CID 162860913) has the molecular formula C19H26O7 and a molecular weight of 366.41 g/mol. Its IUPAC name is [(3aS,5R,6S,7S,8S,8aR)-7-[(E)-but-2-enoyl]-5,7-dihydroxy-6-methyl-3-methylidene-2-oxo-3a,4,5,6,8,8a-hexahydrocyclohepta[b]furan-8-yl] 2-methylpropanoate.
| Compound Name | [(3aS,5R,6S,7S,8S,8aR)-7-[(E)-but-2-enoyl]-5,7-dihydroxy-6-methyl-3-methylidene-2-oxo-3a,4,5,6,8,8a-hexahydrocyclohepta[b]furan-8-yl] 2-methylpropanoate |
|---|---|
| PubChem CID | 162860913 |
| Molecular Formula | C19H26O7 |
| Molecular Weight | 366.41 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | [(3aS,5R,6S,7S,8S,8aR)-7-[(E)-but-2-enoyl]-5,7-dihydroxy-6-methyl-3-methylidene-2-oxo-3a,4,5,6,8,8a-hexahydrocyclohepta[b]furan-8-yl] 2-methylpropanoate |
| SMILES | C=C1C(=O)O[C@@H]2[C@H]1C[C@@H](O)[C@H](C)[C@@](O)(C(=O)/C=C/C)[C@H]2OC(=O)C(C)C |
| InChI | InChI=1S/C19H26O7/c1-6-7-14(21)19(24)11(5)13(20)8-12-10(4)18(23)25-15(12)16(19)26-17(22)9(2)3/h6-7,9,11-13,15-16,20,24H,4,8H2,1-3,5H3/b7-6+/t11-,12-,13+,15+,16-,19+/m0/s1 |
| InChIKey | XFWZQSBQRLKCPR-ULZULHNCSA-N |
| XLogP | 0.93 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.41 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|