C24H34O9 — CID 123441477
[(1S,2S,3R,7R,8S,9R,11R,13S)-1,9-dihydroxy-9,13-dimethyl-4-methylidene-8-(2-methylpropanoyloxy)-5-oxo-6,14-dioxatricyclo[9.2.1.03,7]tetradecan-2-yl] 2-methylbut-2-enoate (PubChem CID 123441477) has the molecular formula C24H34O9 and a molecular weight of 466.53 g/mol. Its IUPAC name is [(1S,2S,3R,7R,8S,9R,11R,13S)-1,9-dihydroxy-9,13-dimethyl-4-methylidene-8-(2-methylpropanoyloxy)-5-oxo-6,14-dioxatricyclo[9.2.1.03,7]tetradecan-2-yl] 2-methylbut-2-enoate.
| Compound Name | [(1S,2S,3R,7R,8S,9R,11R,13S)-1,9-dihydroxy-9,13-dimethyl-4-methylidene-8-(2-methylpropanoyloxy)-5-oxo-6,14-dioxatricyclo[9.2.1.03,7]tetradecan-2-yl] 2-methylbut-2-enoate |
|---|---|
| PubChem CID | 123441477 |
| Molecular Formula | C24H34O9 |
| Molecular Weight | 466.53 g/mol |
| Exact Mass | 466.22 |
| IUPAC Name | [(1S,2S,3R,7R,8S,9R,11R,13S)-1,9-dihydroxy-9,13-dimethyl-4-methylidene-8-(2-methylpropanoyloxy)-5-oxo-6,14-dioxatricyclo[9.2.1.03,7]tetradecan-2-yl] 2-methylbut-2-enoate |
| SMILES | C=C1C(=O)O[C@@H]2[C@@H]1[C@H](OC(=O)C(C)=CC)[C@@]1(O)O[C@H](C[C@@H]1C)C[C@@](C)(O)[C@H]2OC(=O)C(C)C |
| InChI | InChI=1S/C24H34O9/c1-8-12(4)21(26)31-18-16-14(6)22(27)30-17(16)19(32-20(25)11(2)3)23(7,28)10-15-9-13(5)24(18,29)33-15/h8,11,13,15-19,28-29H,6,9-10H2,1-5,7H3/t13-,15+,16+,17+,18-,19-,23+,24-/m0/s1 |
| InChIKey | DZCYDWDYBJALJJ-VYHYDVMLSA-N |
| XLogP | 1.80 |
| TPSA | 128.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.53 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|