C26H32O9 — CID 162925041
[5,8a-dimethyl-1-methylidene-4-(2-methylpropanoyloxy)-2,8-dioxo-3a,4,5,5a,9,9a-hexahydroazuleno[6,5-b]furan-9-yl] 2-(acetyloxymethyl)but-2-enoate (PubChem CID 162925041) has the molecular formula C26H32O9 and a molecular weight of 488.53 g/mol. Its IUPAC name is [5,8a-dimethyl-1-methylidene-4-(2-methylpropanoyloxy)-2,8-dioxo-3a,4,5,5a,9,9a-hexahydroazuleno[6,5-b]furan-9-yl] 2-(acetyloxymethyl)but-2-enoate.
| Compound Name | [5,8a-dimethyl-1-methylidene-4-(2-methylpropanoyloxy)-2,8-dioxo-3a,4,5,5a,9,9a-hexahydroazuleno[6,5-b]furan-9-yl] 2-(acetyloxymethyl)but-2-enoate |
|---|---|
| PubChem CID | 162925041 |
| Molecular Formula | C26H32O9 |
| Molecular Weight | 488.53 g/mol |
| Exact Mass | 488.20 |
| IUPAC Name | [5,8a-dimethyl-1-methylidene-4-(2-methylpropanoyloxy)-2,8-dioxo-3a,4,5,5a,9,9a-hexahydroazuleno[6,5-b]furan-9-yl] 2-(acetyloxymethyl)but-2-enoate |
| SMILES | C=C1C(=O)OC2C(OC(=O)C(C)C)C(C)C3C=CC(=O)C3(C)C(OC(=O)C(=CC)COC(C)=O)C12 |
| InChI | InChI=1S/C26H32O9/c1-8-16(11-32-15(6)27)25(31)35-22-19-14(5)24(30)34-21(19)20(33-23(29)12(2)3)13(4)17-9-10-18(28)26(17,22)7/h8-10,12-13,17,19-22H,5,11H2,1-4,6-7H3 |
| InChIKey | UIOBDSTXGJLASQ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 122.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.53 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|