C24H30O8 — CID 14287114
[5,8a-dimethyl-4-(3-methylbutanoyloxy)-1-methylidene-2,8-dioxo-3a,4,5,5a,9,9a-hexahydroazuleno[6,5-b]furan-9-yl] 2-methyloxirane-2-carboxylate (PubChem CID 14287114) has the molecular formula C24H30O8 and a molecular weight of 446.50 g/mol. Its IUPAC name is [5,8a-dimethyl-4-(3-methylbutanoyloxy)-1-methylidene-2,8-dioxo-3a,4,5,5a,9,9a-hexahydroazuleno[6,5-b]furan-9-yl] 2-methyloxirane-2-carboxylate.
| Compound Name | [5,8a-dimethyl-4-(3-methylbutanoyloxy)-1-methylidene-2,8-dioxo-3a,4,5,5a,9,9a-hexahydroazuleno[6,5-b]furan-9-yl] 2-methyloxirane-2-carboxylate |
|---|---|
| PubChem CID | 14287114 |
| Molecular Formula | C24H30O8 |
| Molecular Weight | 446.50 g/mol |
| Exact Mass | 446.19 |
| IUPAC Name | [5,8a-dimethyl-4-(3-methylbutanoyloxy)-1-methylidene-2,8-dioxo-3a,4,5,5a,9,9a-hexahydroazuleno[6,5-b]furan-9-yl] 2-methyloxirane-2-carboxylate |
| SMILES | C=C1C(=O)OC2C(OC(=O)CC(C)C)C(C)C3C=CC(=O)C3(C)C(OC(=O)C3(C)CO3)C12 |
| InChI | InChI=1S/C24H30O8/c1-11(2)9-16(26)30-18-12(3)14-7-8-15(25)24(14,6)20(32-22(28)23(5)10-29-23)17-13(4)21(27)31-19(17)18/h7-8,11-12,14,17-20H,4,9-10H2,1-3,5-6H3 |
| InChIKey | JKWXXTNYYLHPTN-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 108.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.50 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|