C22H30O9 — CID 163002993
[5-acetyloxy-6-hydroxy-10-(hydroxymethyl)-6-methyl-3-methylidene-2,7-dioxo-3a,4,5,10,11,11a-hexahydrocyclodeca[b]furan-4-yl] 3-methylbutanoate (PubChem CID 163002993) has the molecular formula C22H30O9 and a molecular weight of 438.47 g/mol. Its IUPAC name is [5-acetyloxy-6-hydroxy-10-(hydroxymethyl)-6-methyl-3-methylidene-2,7-dioxo-3a,4,5,10,11,11a-hexahydrocyclodeca[b]furan-4-yl] 3-methylbutanoate.
| Compound Name | [5-acetyloxy-6-hydroxy-10-(hydroxymethyl)-6-methyl-3-methylidene-2,7-dioxo-3a,4,5,10,11,11a-hexahydrocyclodeca[b]furan-4-yl] 3-methylbutanoate |
|---|---|
| PubChem CID | 163002993 |
| Molecular Formula | C22H30O9 |
| Molecular Weight | 438.47 g/mol |
| Exact Mass | 438.19 |
| IUPAC Name | [5-acetyloxy-6-hydroxy-10-(hydroxymethyl)-6-methyl-3-methylidene-2,7-dioxo-3a,4,5,10,11,11a-hexahydrocyclodeca[b]furan-4-yl] 3-methylbutanoate |
| SMILES | C=C1C(=O)OC2CC(CO)C=CC(=O)C(C)(O)C(OC(C)=O)C(OC(=O)CC(C)C)C12 |
| InChI | InChI=1S/C22H30O9/c1-11(2)8-17(26)31-19-18-12(3)21(27)30-15(18)9-14(10-23)6-7-16(25)22(5,28)20(19)29-13(4)24/h6-7,11,14-15,18-20,23,28H,3,8-10H2,1-2,4-5H3 |
| InChIKey | QPBUKUPRAWUHCJ-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 136.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.47 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|