C24H30O8 — CID 162958033
[(3aR,4S,5R,6R,8Z,10S,11aR)-6-hydroxy-6,10-dimethyl-3-methylidene-4-(2-methylprop-2-enoyloxy)-2,7-dioxo-3a,4,5,10,11,11a-hexahydrocyclodeca[b]furan-5-yl] (Z)-2-methylbut-2-enoate (PubChem CID 162958033) has the molecular formula C24H30O8 and a molecular weight of 446.50 g/mol. Its IUPAC name is [(3aR,4S,5R,6R,8Z,10S,11aR)-6-hydroxy-6,10-dimethyl-3-methylidene-4-(2-methylprop-2-enoyloxy)-2,7-dioxo-3a,4,5,10,11,11a-hexahydrocyclodeca[b]furan-5-yl] (Z)-2-methylbut-2-enoate.
| Compound Name | [(3aR,4S,5R,6R,8Z,10S,11aR)-6-hydroxy-6,10-dimethyl-3-methylidene-4-(2-methylprop-2-enoyloxy)-2,7-dioxo-3a,4,5,10,11,11a-hexahydrocyclodeca[b]furan-5-yl] (Z)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 162958033 |
| Molecular Formula | C24H30O8 |
| Molecular Weight | 446.50 g/mol |
| Exact Mass | 446.19 |
| IUPAC Name | [(3aR,4S,5R,6R,8Z,10S,11aR)-6-hydroxy-6,10-dimethyl-3-methylidene-4-(2-methylprop-2-enoyloxy)-2,7-dioxo-3a,4,5,10,11,11a-hexahydrocyclodeca[b]furan-5-yl] (Z)-2-methylbut-2-enoate |
| SMILES | C=C(C)C(=O)O[C@H]1[C@@H]2C(=C)C(=O)O[C@@H]2C[C@H](C)/C=C\C(=O)[C@](C)(O)[C@@H]1OC(=O)/C(C)=C\C |
| InChI | InChI=1S/C24H30O8/c1-8-14(5)22(27)32-20-19(31-21(26)12(2)3)18-15(6)23(28)30-16(18)11-13(4)9-10-17(25)24(20,7)29/h8-10,13,16,18-20,29H,2,6,11H2,1,3-5,7H3/b10-9-,14-8-/t13-,16-,18-,19+,20-,24+/m1/s1 |
| InChIKey | JZPQLIUKOAJRPF-KSJHYCLFSA-N |
| XLogP | 2.37 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.50 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|