C22H26O8 — CID 162972127
(4,7-dihydroxy-9-methyl-3,6-dimethylidene-2-oxo-4,5,6a,7,9a,9b-hexahydro-3aH-azuleno[4,5-b]furan-5-yl) 2-(acetyloxymethyl)but-2-enoate (PubChem CID 162972127) has the molecular formula C22H26O8 and a molecular weight of 418.44 g/mol. Its IUPAC name is (4,7-dihydroxy-9-methyl-3,6-dimethylidene-2-oxo-4,5,6a,7,9a,9b-hexahydro-3aH-azuleno[4,5-b]furan-5-yl) 2-(acetyloxymethyl)but-2-enoate.
| Compound Name | (4,7-dihydroxy-9-methyl-3,6-dimethylidene-2-oxo-4,5,6a,7,9a,9b-hexahydro-3aH-azuleno[4,5-b]furan-5-yl) 2-(acetyloxymethyl)but-2-enoate |
|---|---|
| PubChem CID | 162972127 |
| Molecular Formula | C22H26O8 |
| Molecular Weight | 418.44 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | (4,7-dihydroxy-9-methyl-3,6-dimethylidene-2-oxo-4,5,6a,7,9a,9b-hexahydro-3aH-azuleno[4,5-b]furan-5-yl) 2-(acetyloxymethyl)but-2-enoate |
| SMILES | C=C1C(=O)OC2C1C(O)C(OC(=O)C(=CC)COC(C)=O)C(=C)C1C(O)C=C(C)C21 |
| InChI | InChI=1S/C22H26O8/c1-6-13(8-28-12(5)23)22(27)29-19-10(3)16-14(24)7-9(2)15(16)20-17(18(19)25)11(4)21(26)30-20/h6-7,14-20,24-25H,3-4,8H2,1-2,5H3 |
| InChIKey | ZQAINRQXYZUDMF-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.44 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|