C25H30O8 — CID 162919776
[(E)-2-[[(3aR,4R,6aR,7R,9aR,9bS)-7-hydroxy-9-methyl-3,6-dimethylidene-2-oxo-4,5,6a,7,9a,9b-hexahydro-3aH-azuleno[4,5-b]furan-4-yl]oxycarbonyl]but-2-enyl] (E)-2-(hydroxymethyl)but-2-enoate (PubChem CID 162919776) has the molecular formula C25H30O8 and a molecular weight of 458.51 g/mol. Its IUPAC name is [(E)-2-[[(3aR,4R,6aR,7R,9aR,9bS)-7-hydroxy-9-methyl-3,6-dimethylidene-2-oxo-4,5,6a,7,9a,9b-hexahydro-3aH-azuleno[4,5-b]furan-4-yl]oxycarbonyl]but-2-enyl] (E)-2-(hydroxymethyl)but-2-enoate.
| Compound Name | [(E)-2-[[(3aR,4R,6aR,7R,9aR,9bS)-7-hydroxy-9-methyl-3,6-dimethylidene-2-oxo-4,5,6a,7,9a,9b-hexahydro-3aH-azuleno[4,5-b]furan-4-yl]oxycarbonyl]but-2-enyl] (E)-2-(hydroxymethyl)but-2-enoate |
|---|---|
| PubChem CID | 162919776 |
| Molecular Formula | C25H30O8 |
| Molecular Weight | 458.51 g/mol |
| Exact Mass | 458.19 |
| IUPAC Name | [(E)-2-[[(3aR,4R,6aR,7R,9aR,9bS)-7-hydroxy-9-methyl-3,6-dimethylidene-2-oxo-4,5,6a,7,9a,9b-hexahydro-3aH-azuleno[4,5-b]furan-4-yl]oxycarbonyl]but-2-enyl] (E)-2-(hydroxymethyl)but-2-enoate |
| SMILES | C=C1C[C@@H](OC(=O)/C(=C/C)COC(=O)/C(=C/C)CO)[C@H]2C(=C)C(=O)O[C@H]2[C@H]2C(C)=C[C@@H](O)[C@@H]12 |
| InChI | InChI=1S/C25H30O8/c1-6-15(10-26)24(29)31-11-16(7-2)25(30)32-18-9-13(4)19-17(27)8-12(3)20(19)22-21(18)14(5)23(28)33-22/h6-8,17-22,26-27H,4-5,9-11H2,1-3H3/b15-6+,16-7+/t17-,18-,19-,20+,21-,22+/m1/s1 |
| InChIKey | RFUWVTBKHFXDFD-FRXPOACDSA-N |
| XLogP | 1.94 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.51 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|