C20H24O5 — CID 163004737
(6,9-dimethyl-3-methylidene-2-oxo-3a,4,5,7,9a,9b-hexahydroazuleno[4,5-b]furan-4-yl) 2-(hydroxymethyl)but-2-enoate (PubChem CID 163004737) has the molecular formula C20H24O5 and a molecular weight of 344.41 g/mol. Its IUPAC name is (6,9-dimethyl-3-methylidene-2-oxo-3a,4,5,7,9a,9b-hexahydroazuleno[4,5-b]furan-4-yl) 2-(hydroxymethyl)but-2-enoate.
| Compound Name | (6,9-dimethyl-3-methylidene-2-oxo-3a,4,5,7,9a,9b-hexahydroazuleno[4,5-b]furan-4-yl) 2-(hydroxymethyl)but-2-enoate |
|---|---|
| PubChem CID | 163004737 |
| Molecular Formula | C20H24O5 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | (6,9-dimethyl-3-methylidene-2-oxo-3a,4,5,7,9a,9b-hexahydroazuleno[4,5-b]furan-4-yl) 2-(hydroxymethyl)but-2-enoate |
| SMILES | C=C1C(=O)OC2C3C(C)=CCC3=C(C)CC(OC(=O)C(=CC)CO)C12 |
| InChI | InChI=1S/C20H24O5/c1-5-13(9-21)20(23)24-15-8-11(3)14-7-6-10(2)16(14)18-17(15)12(4)19(22)25-18/h5-6,15-18,21H,4,7-9H2,1-3H3 |
| InChIKey | FVFUKWZLGLEYBQ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|