C20H20O6 — CID 162887837
[(5R,6S,7S,11R,12S)-13-methyl-8-methylidene-3,9-dioxo-4,10-dioxatetracyclo[10.3.0.02,5.07,11]pentadeca-1,13-dien-6-yl] (E)-2-methylbut-2-enoate (PubChem CID 162887837) has the molecular formula C20H20O6 and a molecular weight of 356.37 g/mol. Its IUPAC name is [(5R,6S,7S,11R,12S)-13-methyl-8-methylidene-3,9-dioxo-4,10-dioxatetracyclo[10.3.0.02,5.07,11]pentadeca-1,13-dien-6-yl] (E)-2-methylbut-2-enoate.
| Compound Name | [(5R,6S,7S,11R,12S)-13-methyl-8-methylidene-3,9-dioxo-4,10-dioxatetracyclo[10.3.0.02,5.07,11]pentadeca-1,13-dien-6-yl] (E)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 162887837 |
| Molecular Formula | C20H20O6 |
| Molecular Weight | 356.37 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | [(5R,6S,7S,11R,12S)-13-methyl-8-methylidene-3,9-dioxo-4,10-dioxatetracyclo[10.3.0.02,5.07,11]pentadeca-1,13-dien-6-yl] (E)-2-methylbut-2-enoate |
| SMILES | C=C1C(=O)O[C@@H]2[C@H]3C(C)=CCC3=C3C(=O)O[C@H]3[C@@H](OC(=O)/C(C)=C/C)[C@@H]12 |
| InChI | InChI=1S/C20H20O6/c1-5-8(2)18(21)25-16-13-10(4)19(22)24-15(13)12-9(3)6-7-11(12)14-17(16)26-20(14)23/h5-6,12-13,15-17H,4,7H2,1-3H3/b8-5+/t12-,13-,15+,16-,17+/m0/s1 |
| InChIKey | ZQNXYIUWXMFILN-KDYYLDKASA-N |
| XLogP | 2.16 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.37 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'four_member_lactones', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|