C15H14O4 — CID 163036133
(5R,7S,11S,12S)-13-methyl-8-methylidene-4,10-dioxatetracyclo[10.3.0.02,5.07,11]pentadeca-1,13-diene-3,9-dione (PubChem CID 163036133) has the molecular formula C15H14O4 and a molecular weight of 258.27 g/mol. Its IUPAC name is (5R,7S,11S,12S)-13-methyl-8-methylidene-4,10-dioxatetracyclo[10.3.0.02,5.07,11]pentadeca-1,13-diene-3,9-dione.
| Compound Name | (5R,7S,11S,12S)-13-methyl-8-methylidene-4,10-dioxatetracyclo[10.3.0.02,5.07,11]pentadeca-1,13-diene-3,9-dione |
|---|---|
| PubChem CID | 163036133 |
| Molecular Formula | C15H14O4 |
| Molecular Weight | 258.27 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | (5R,7S,11S,12S)-13-methyl-8-methylidene-4,10-dioxatetracyclo[10.3.0.02,5.07,11]pentadeca-1,13-diene-3,9-dione |
| SMILES | C=C1C(=O)O[C@@H]2[C@H]3C(C)=CCC3=C3C(=O)O[C@@H]3C[C@@H]12 |
| InChI | InChI=1S/C15H14O4/c1-6-3-4-8-11(6)13-9(7(2)14(16)19-13)5-10-12(8)15(17)18-10/h3,9-11,13H,2,4-5H2,1H3/t9-,10+,11-,13-/m0/s1 |
| InChIKey | PKKVIBKJSUOHMK-NOHGZBONSA-N |
| XLogP | 1.68 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.27 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'four_member_lactones', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|