C22H24O9 — CID 162960451
[(2Z,4S,8S,9S,10S,11R)-10-hydroxy-2,11-dimethyl-7-methylidene-6,12-dioxo-5,14-dioxatricyclo[9.2.1.04,8]tetradeca-1(13),2-dien-9-yl] (E)-2-(acetyloxymethyl)but-2-enoate (PubChem CID 162960451) has the molecular formula C22H24O9 and a molecular weight of 432.43 g/mol. Its IUPAC name is [(2Z,4S,8S,9S,10S,11R)-10-hydroxy-2,11-dimethyl-7-methylidene-6,12-dioxo-5,14-dioxatricyclo[9.2.1.04,8]tetradeca-1(13),2-dien-9-yl] (E)-2-(acetyloxymethyl)but-2-enoate.
| Compound Name | [(2Z,4S,8S,9S,10S,11R)-10-hydroxy-2,11-dimethyl-7-methylidene-6,12-dioxo-5,14-dioxatricyclo[9.2.1.04,8]tetradeca-1(13),2-dien-9-yl] (E)-2-(acetyloxymethyl)but-2-enoate |
|---|---|
| PubChem CID | 162960451 |
| Molecular Formula | C22H24O9 |
| Molecular Weight | 432.43 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | [(2Z,4S,8S,9S,10S,11R)-10-hydroxy-2,11-dimethyl-7-methylidene-6,12-dioxo-5,14-dioxatricyclo[9.2.1.04,8]tetradeca-1(13),2-dien-9-yl] (E)-2-(acetyloxymethyl)but-2-enoate |
| SMILES | C=C1C(=O)O[C@H]2/C=C(/C)C3=CC(=O)[C@](C)(O3)[C@@H](O)[C@@H](OC(=O)/C(=C/C)COC(C)=O)[C@@H]12 |
| InChI | InChI=1S/C22H24O9/c1-6-13(9-28-12(4)23)21(27)30-18-17-11(3)20(26)29-15(17)7-10(2)14-8-16(24)22(5,31-14)19(18)25/h6-8,15,17-19,25H,3,9H2,1-2,4-5H3/b10-7-,13-6+/t15-,17-,18-,19-,22-/m0/s1 |
| InChIKey | KMBBXTNXKQUZTP-GSWVJREDSA-N |
| XLogP | 1.07 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.43 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|