C20H28O6 — CID 162955970
(8a,9-dihydroxy-3,4a,5-trimethyl-2-oxo-5,6,7,8,9,9a-hexahydro-4H-benzo[f][1]benzofuran-8-yl) 2-methylbut-2-enoate (PubChem CID 162955970) has the molecular formula C20H28O6 and a molecular weight of 364.44 g/mol. Its IUPAC name is (8a,9-dihydroxy-3,4a,5-trimethyl-2-oxo-5,6,7,8,9,9a-hexahydro-4H-benzo[f][1]benzofuran-8-yl) 2-methylbut-2-enoate.
| Compound Name | (8a,9-dihydroxy-3,4a,5-trimethyl-2-oxo-5,6,7,8,9,9a-hexahydro-4H-benzo[f][1]benzofuran-8-yl) 2-methylbut-2-enoate |
|---|---|
| PubChem CID | 162955970 |
| Molecular Formula | C20H28O6 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | (8a,9-dihydroxy-3,4a,5-trimethyl-2-oxo-5,6,7,8,9,9a-hexahydro-4H-benzo[f][1]benzofuran-8-yl) 2-methylbut-2-enoate |
| SMILES | CC=C(C)C(=O)OC1CCC(C)C2(C)CC3=C(C)C(=O)OC3C(O)C12O |
| InChI | InChI=1S/C20H28O6/c1-6-10(2)17(22)25-14-8-7-11(3)19(5)9-13-12(4)18(23)26-15(13)16(21)20(14,19)24/h6,11,14-16,21,24H,7-9H2,1-5H3 |
| InChIKey | ASPNSXLDAYXWRB-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|