C20H28O7 — CID 102141781
[(4S,4aR,5S,8S,8aS,9R,9aR)-4,9,9a-trihydroxy-3,4a,5-trimethyl-2-oxo-5,6,7,8,8a,9-hexahydro-4H-benzo[f][1]benzofuran-8-yl] (Z)-2-methylbut-2-enoate (PubChem CID 102141781) has the molecular formula C20H28O7 and a molecular weight of 380.44 g/mol. Its IUPAC name is [(4S,4aR,5S,8S,8aS,9R,9aR)-4,9,9a-trihydroxy-3,4a,5-trimethyl-2-oxo-5,6,7,8,8a,9-hexahydro-4H-benzo[f][1]benzofuran-8-yl] (Z)-2-methylbut-2-enoate.
| Compound Name | [(4S,4aR,5S,8S,8aS,9R,9aR)-4,9,9a-trihydroxy-3,4a,5-trimethyl-2-oxo-5,6,7,8,8a,9-hexahydro-4H-benzo[f][1]benzofuran-8-yl] (Z)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 102141781 |
| Molecular Formula | C20H28O7 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | [(4S,4aR,5S,8S,8aS,9R,9aR)-4,9,9a-trihydroxy-3,4a,5-trimethyl-2-oxo-5,6,7,8,8a,9-hexahydro-4H-benzo[f][1]benzofuran-8-yl] (Z)-2-methylbut-2-enoate |
| SMILES | C/C=C(/C)C(=O)O[C@H]1CC[C@H](C)[C@]2(C)[C@H]1[C@@H](O)[C@]1(O)OC(=O)C(C)=C1[C@H]2O |
| InChI | InChI=1S/C20H28O7/c1-6-9(2)17(23)26-12-8-7-10(3)19(5)14(12)16(22)20(25)13(15(19)21)11(4)18(24)27-20/h6,10,12,14-16,21-22,25H,7-8H2,1-5H3/b9-6-/t10-,12-,14+,15+,16+,19+,20+/m0/s1 |
| InChIKey | HHCKJGODPRJJIX-DNSPSQASSA-N |
| XLogP | 1.21 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|