C20H26O5 — CID 162988359
(4-hydroxy-3,4a,5-trimethyl-9-oxo-4,5,6,7,8,8a-hexahydrobenzo[f][1]benzofuran-8-yl) 2-methylbut-2-enoate (PubChem CID 162988359) has the molecular formula C20H26O5 and a molecular weight of 346.42 g/mol. Its IUPAC name is (4-hydroxy-3,4a,5-trimethyl-9-oxo-4,5,6,7,8,8a-hexahydrobenzo[f][1]benzofuran-8-yl) 2-methylbut-2-enoate.
| Compound Name | (4-hydroxy-3,4a,5-trimethyl-9-oxo-4,5,6,7,8,8a-hexahydrobenzo[f][1]benzofuran-8-yl) 2-methylbut-2-enoate |
|---|---|
| PubChem CID | 162988359 |
| Molecular Formula | C20H26O5 |
| Molecular Weight | 346.42 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | (4-hydroxy-3,4a,5-trimethyl-9-oxo-4,5,6,7,8,8a-hexahydrobenzo[f][1]benzofuran-8-yl) 2-methylbut-2-enoate |
| SMILES | CC=C(C)C(=O)OC1CCC(C)C2(C)C(O)c3c(C)coc3C(=O)C12 |
| InChI | InChI=1S/C20H26O5/c1-6-10(2)19(23)25-13-8-7-12(4)20(5)15(13)16(21)17-14(18(20)22)11(3)9-24-17/h6,9,12-13,15,18,22H,7-8H2,1-5H3 |
| InChIKey | JSAITVSNDUGDOQ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.42 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|