C15H20O4 — CID 15627966
(4S,4aR,5S,8S,8aR)-4,8-dihydroxy-3,4a,5-trimethyl-4,5,6,7,8,8a-hexahydrobenzo[f][1]benzofuran-9-one (PubChem CID 15627966) has the molecular formula C15H20O4 and a molecular weight of 264.32 g/mol. Its IUPAC name is (4S,4aR,5S,8S,8aR)-4,8-dihydroxy-3,4a,5-trimethyl-4,5,6,7,8,8a-hexahydrobenzo[f][1]benzofuran-9-one.
| Compound Name | (4S,4aR,5S,8S,8aR)-4,8-dihydroxy-3,4a,5-trimethyl-4,5,6,7,8,8a-hexahydrobenzo[f][1]benzofuran-9-one |
|---|---|
| PubChem CID | 15627966 |
| Molecular Formula | C15H20O4 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | (4S,4aR,5S,8S,8aR)-4,8-dihydroxy-3,4a,5-trimethyl-4,5,6,7,8,8a-hexahydrobenzo[f][1]benzofuran-9-one |
| SMILES | Cc1coc2c1[C@@H](O)[C@]1(C)[C@@H](C)CC[C@H](O)[C@@H]1C2=O |
| InChI | InChI=1S/C15H20O4/c1-7-6-19-13-10(7)14(18)15(3)8(2)4-5-9(16)11(15)12(13)17/h6,8-9,11,14,16,18H,4-5H2,1-3H3/t8-,9-,11+,14+,15+/m0/s1 |
| InChIKey | IINQVPBERPRLGN-KJZCUWKRSA-N |
| XLogP | 2.23 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |