C16H22O4 — CID 163087334
(4S,4aR,5R,6S,8aR)-6-hydroxy-4-methoxy-3,4a,5-trimethyl-4,5,6,7,8,8a-hexahydrobenzo[f][1]benzofuran-9-one (PubChem CID 163087334) has the molecular formula C16H22O4 and a molecular weight of 278.35 g/mol. Its IUPAC name is (4S,4aR,5R,6S,8aR)-6-hydroxy-4-methoxy-3,4a,5-trimethyl-4,5,6,7,8,8a-hexahydrobenzo[f][1]benzofuran-9-one.
| Compound Name | (4S,4aR,5R,6S,8aR)-6-hydroxy-4-methoxy-3,4a,5-trimethyl-4,5,6,7,8,8a-hexahydrobenzo[f][1]benzofuran-9-one |
|---|---|
| PubChem CID | 163087334 |
| Molecular Formula | C16H22O4 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | (4S,4aR,5R,6S,8aR)-6-hydroxy-4-methoxy-3,4a,5-trimethyl-4,5,6,7,8,8a-hexahydrobenzo[f][1]benzofuran-9-one |
| SMILES | CO[C@@H]1c2c(C)coc2C(=O)[C@@H]2CC[C@H](O)[C@H](C)[C@@]12C |
| InChI | InChI=1S/C16H22O4/c1-8-7-20-14-12(8)15(19-4)16(3)9(2)11(17)6-5-10(16)13(14)18/h7,9-11,15,17H,5-6H2,1-4H3/t9-,10-,11-,15+,16+/m0/s1 |
| InChIKey | IFAGLCHIPRNJAM-SQXIKUFJSA-N |
| XLogP | 2.89 |
| TPSA | 59.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |