C22H30O5 — CID 163019282
(4-acetyloxy-3,4a,5-trimethyl-5,6,7,8,8a,9-hexahydro-4H-benzo[f][1]benzofuran-6-yl) 2-methylbut-2-enoate (PubChem CID 163019282) has the molecular formula C22H30O5 and a molecular weight of 374.48 g/mol. Its IUPAC name is (4-acetyloxy-3,4a,5-trimethyl-5,6,7,8,8a,9-hexahydro-4H-benzo[f][1]benzofuran-6-yl) 2-methylbut-2-enoate.
| Compound Name | (4-acetyloxy-3,4a,5-trimethyl-5,6,7,8,8a,9-hexahydro-4H-benzo[f][1]benzofuran-6-yl) 2-methylbut-2-enoate |
|---|---|
| PubChem CID | 163019282 |
| Molecular Formula | C22H30O5 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.21 |
| IUPAC Name | (4-acetyloxy-3,4a,5-trimethyl-5,6,7,8,8a,9-hexahydro-4H-benzo[f][1]benzofuran-6-yl) 2-methylbut-2-enoate |
| SMILES | CC=C(C)C(=O)OC1CCC2Cc3occ(C)c3C(OC(C)=O)C2(C)C1C |
| InChI | InChI=1S/C22H30O5/c1-7-12(2)21(24)27-17-9-8-16-10-18-19(13(3)11-25-18)20(26-15(5)23)22(16,6)14(17)4/h7,11,14,16-17,20H,8-10H2,1-6H3 |
| InChIKey | LJMVPNYZXHUHTL-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|