C22H30O6 — CID 162883291
[6-acetyloxy-5-(hydroxymethyl)-3,4a-dimethyl-5,6,7,8,8a,9-hexahydro-4H-benzo[f][1]benzofuran-4-yl] 2-methylbut-2-enoate (PubChem CID 162883291) has the molecular formula C22H30O6 and a molecular weight of 390.48 g/mol. Its IUPAC name is [6-acetyloxy-5-(hydroxymethyl)-3,4a-dimethyl-5,6,7,8,8a,9-hexahydro-4H-benzo[f][1]benzofuran-4-yl] 2-methylbut-2-enoate.
| Compound Name | [6-acetyloxy-5-(hydroxymethyl)-3,4a-dimethyl-5,6,7,8,8a,9-hexahydro-4H-benzo[f][1]benzofuran-4-yl] 2-methylbut-2-enoate |
|---|---|
| PubChem CID | 162883291 |
| Molecular Formula | C22H30O6 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.20 |
| IUPAC Name | [6-acetyloxy-5-(hydroxymethyl)-3,4a-dimethyl-5,6,7,8,8a,9-hexahydro-4H-benzo[f][1]benzofuran-4-yl] 2-methylbut-2-enoate |
| SMILES | CC=C(C)C(=O)OC1c2c(C)coc2CC2CCC(OC(C)=O)C(CO)C21C |
| InChI | InChI=1S/C22H30O6/c1-6-12(2)21(25)28-20-19-13(3)11-26-18(19)9-15-7-8-17(27-14(4)24)16(10-23)22(15,20)5/h6,11,15-17,20,23H,7-10H2,1-5H3 |
| InChIKey | ZWHBJXTWIQHNDR-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 85.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|