C20H28O5 — CID 154812604
[(4aR,5S)-9a-hydroxy-3,4a,5-trimethyl-2-oxo-5,6,7,8,8a,9-hexahydro-4H-benzo[f][1]benzofuran-7-yl] (Z)-2-methylbut-2-enoate (PubChem CID 154812604) has the molecular formula C20H28O5 and a molecular weight of 348.44 g/mol. Its IUPAC name is [(4aR,5S)-9a-hydroxy-3,4a,5-trimethyl-2-oxo-5,6,7,8,8a,9-hexahydro-4H-benzo[f][1]benzofuran-7-yl] (Z)-2-methylbut-2-enoate.
| Compound Name | [(4aR,5S)-9a-hydroxy-3,4a,5-trimethyl-2-oxo-5,6,7,8,8a,9-hexahydro-4H-benzo[f][1]benzofuran-7-yl] (Z)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 154812604 |
| Molecular Formula | C20H28O5 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.19 |
| IUPAC Name | [(4aR,5S)-9a-hydroxy-3,4a,5-trimethyl-2-oxo-5,6,7,8,8a,9-hexahydro-4H-benzo[f][1]benzofuran-7-yl] (Z)-2-methylbut-2-enoate |
| SMILES | C/C=C(/C)C(=O)OC1CC2CC3(O)OC(=O)C(C)=C3C[C@]2(C)[C@@H](C)C1 |
| InChI | InChI=1S/C20H28O5/c1-6-11(2)17(21)24-15-7-12(3)19(5)10-16-13(4)18(22)25-20(16,23)9-14(19)8-15/h6,12,14-15,23H,7-10H2,1-5H3/b11-6-/t12-,14?,15?,19+,20?/m0/s1 |
| InChIKey | BNKQCXTYXHSKGJ-AKDYYQRESA-N |
| XLogP | 3.27 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|