C21H31NO4 — CID 163053794
(9a-methoxy-3,4a,5-trimethyl-2-oxo-1,4,5,6,7,8,8a,9-octahydrobenzo[f]indol-6-yl) 2-methylbut-2-enoate (PubChem CID 163053794) has the molecular formula C21H31NO4 and a molecular weight of 361.48 g/mol. Its IUPAC name is (9a-methoxy-3,4a,5-trimethyl-2-oxo-1,4,5,6,7,8,8a,9-octahydrobenzo[f]indol-6-yl) 2-methylbut-2-enoate.
| Compound Name | (9a-methoxy-3,4a,5-trimethyl-2-oxo-1,4,5,6,7,8,8a,9-octahydrobenzo[f]indol-6-yl) 2-methylbut-2-enoate |
|---|---|
| PubChem CID | 163053794 |
| Molecular Formula | C21H31NO4 |
| Molecular Weight | 361.48 g/mol |
| Exact Mass | 361.23 |
| IUPAC Name | (9a-methoxy-3,4a,5-trimethyl-2-oxo-1,4,5,6,7,8,8a,9-octahydrobenzo[f]indol-6-yl) 2-methylbut-2-enoate |
| SMILES | CC=C(C)C(=O)OC1CCC2CC3(OC)NC(=O)C(C)=C3CC2(C)C1C |
| InChI | InChI=1S/C21H31NO4/c1-7-12(2)19(24)26-17-9-8-15-10-21(25-6)16(13(3)18(23)22-21)11-20(15,5)14(17)4/h7,14-15,17H,8-11H2,1-6H3,(H,22,23) |
| InChIKey | WUJHORJLMJSWRX-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.48 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|