C22H32O7 — CID 163048713
(1-acetyloxy-1,3',3',4a-tetramethyl-6-oxospiro[2,3,4,5,8,8a-hexahydronaphthalene-7,2'-oxirane]-2-yl) 2,3-dimethyloxirane-2-carboxylate (PubChem CID 163048713) has the molecular formula C22H32O7 and a molecular weight of 408.49 g/mol. Its IUPAC name is (1-acetyloxy-1,3',3',4a-tetramethyl-6-oxospiro[2,3,4,5,8,8a-hexahydronaphthalene-7,2'-oxirane]-2-yl) 2,3-dimethyloxirane-2-carboxylate.
| Compound Name | (1-acetyloxy-1,3',3',4a-tetramethyl-6-oxospiro[2,3,4,5,8,8a-hexahydronaphthalene-7,2'-oxirane]-2-yl) 2,3-dimethyloxirane-2-carboxylate |
|---|---|
| PubChem CID | 163048713 |
| Molecular Formula | C22H32O7 |
| Molecular Weight | 408.49 g/mol |
| Exact Mass | 408.21 |
| IUPAC Name | (1-acetyloxy-1,3',3',4a-tetramethyl-6-oxospiro[2,3,4,5,8,8a-hexahydronaphthalene-7,2'-oxirane]-2-yl) 2,3-dimethyloxirane-2-carboxylate |
| SMILES | CC(=O)OC1(C)C(OC(=O)C2(C)OC2C)CCC2(C)CC(=O)C3(CC21)OC3(C)C |
| InChI | InChI=1S/C22H32O7/c1-12-20(6,27-12)17(25)26-16-8-9-19(5)11-15(24)22(18(3,4)29-22)10-14(19)21(16,7)28-13(2)23/h12,14,16H,8-11H2,1-7H3 |
| InChIKey | IQXLFFRFLKUHGH-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 94.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.49 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|