C26H38O8 — CID 162943628
[(1R,2S,4S,5R,8R,9S,10R,13R,15R)-2,10,15-trihydroxy-5-methoxycarbonyl-5,9-dimethyl-14-methylidene-8-tetracyclo[11.2.1.01,10.04,9]hexadecanyl] (2S,3S)-2,3-dimethyloxirane-2-carboxylate (PubChem CID 162943628) has the molecular formula C26H38O8 and a molecular weight of 478.58 g/mol. Its IUPAC name is [(1R,2S,4S,5R,8R,9S,10R,13R,15R)-2,10,15-trihydroxy-5-methoxycarbonyl-5,9-dimethyl-14-methylidene-8-tetracyclo[11.2.1.01,10.04,9]hexadecanyl] (2S,3S)-2,3-dimethyloxirane-2-carboxylate.
| Compound Name | [(1R,2S,4S,5R,8R,9S,10R,13R,15R)-2,10,15-trihydroxy-5-methoxycarbonyl-5,9-dimethyl-14-methylidene-8-tetracyclo[11.2.1.01,10.04,9]hexadecanyl] (2S,3S)-2,3-dimethyloxirane-2-carboxylate |
|---|---|
| PubChem CID | 162943628 |
| Molecular Formula | C26H38O8 |
| Molecular Weight | 478.58 g/mol |
| Exact Mass | 478.26 |
| IUPAC Name | [(1R,2S,4S,5R,8R,9S,10R,13R,15R)-2,10,15-trihydroxy-5-methoxycarbonyl-5,9-dimethyl-14-methylidene-8-tetracyclo[11.2.1.01,10.04,9]hexadecanyl] (2S,3S)-2,3-dimethyloxirane-2-carboxylate |
| SMILES | C=C1[C@@H]2CC[C@@]3(O)[C@]4(C)[C@H](OC(=O)[C@@]5(C)O[C@H]5C)CC[C@@](C)(C(=O)OC)[C@H]4C[C@H](O)[C@]3(C2)[C@@H]1O |
| InChI | InChI=1S/C26H38O8/c1-13-15-7-10-26(31)23(4)16(11-17(27)25(26,12-15)19(13)28)22(3,20(29)32-6)9-8-18(23)33-21(30)24(5)14(2)34-24/h14-19,27-28,31H,1,7-12H2,2-6H3/t14-,15+,16+,17-,18+,19+,22+,23-,24-,25+,26+/m0/s1 |
| InChIKey | FYPUWNFNIBHALG-GJPYWYJTSA-N |
| XLogP | 1.88 |
| TPSA | 125.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.58 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|